C24H44O7Si — CID 10896029
(1R,3S,3aR,4aR,8aR,8bS)-3a-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-8a-(methoxymethoxymethyl)-6,8b-dimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3-ol (PubChem CID 10896029) has the molecular formula C24H44O7Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (1R,3S,3aR,4aR,8aR,8bS)-3a-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-8a-(methoxymethoxymethyl)-6,8b-dimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3-ol.
| Compound Name | (1R,3S,3aR,4aR,8aR,8bS)-3a-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-8a-(methoxymethoxymethyl)-6,8b-dimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3-ol |
|---|---|
| PubChem CID | 10896029 |
| Molecular Formula | C24H44O7Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | (1R,3S,3aR,4aR,8aR,8bS)-3a-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethoxy)-8a-(methoxymethoxymethyl)-6,8b-dimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3-ol |
| SMILES | COCOC[C@]12CCC(C)=C[C@H]1O[C@]1(O[Si](C)(C)C(C)(C)C)[C@@H](O)C[C@@H](OCOC)[C@]21C |
| InChI | InChI=1S/C24H44O7Si/c1-17-10-11-23(14-28-15-26-6)20(12-17)30-24(31-32(8,9)21(2,3)4)18(25)13-19(22(23,24)5)29-16-27-7/h12,18-20,25H,10-11,13-16H2,1-9H3/t18-,19+,20+,22+,23+,24-/m0/s1 |
| InChIKey | AWUDLJQCSOUTJV-MCIGMTSASA-N |
| XLogP | 4.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|