C25H42NO6P — CID 10896179
ditert-butyl 2-[[anilinomethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]methyl]pentanedioate (PubChem CID 10896179) has the molecular formula C25H42NO6P and a molecular weight of 483.59 g/mol. Its IUPAC name is ditert-butyl 2-[[anilinomethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]methyl]pentanedioate.
| Compound Name | ditert-butyl 2-[[anilinomethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]methyl]pentanedioate |
|---|---|
| PubChem CID | 10896179 |
| Molecular Formula | C25H42NO6P |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | ditert-butyl 2-[[anilinomethyl-[(2-methylpropan-2-yl)oxy]phosphoryl]methyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(CP(=O)(CNc1ccccc1)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H42NO6P/c1-23(2,3)30-21(27)16-15-19(22(28)31-24(4,5)6)17-33(29,32-25(7,8)9)18-26-20-13-11-10-12-14-20/h10-14,19,26H,15-18H2,1-9H3 |
| InChIKey | KIOCEPJGSUBGSX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|