C33H46O5Si — CID 10896923
diethyl 2-[(1R,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-prop-1-en-2-ylcyclopentyl]propanedioate (PubChem CID 10896923) has the molecular formula C33H46O5Si and a molecular weight of 550.81 g/mol. Its IUPAC name is diethyl 2-[(1R,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-prop-1-en-2-ylcyclopentyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-prop-1-en-2-ylcyclopentyl]propanedioate |
|---|---|
| PubChem CID | 10896923 |
| Molecular Formula | C33H46O5Si |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | diethyl 2-[(1R,2R,3R)-3-[tert-butyl(diphenyl)silyl]oxy-4,4-dimethyl-2-prop-1-en-2-ylcyclopentyl]propanedioate |
| SMILES | C=C(C)[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)(C)C[C@H]1C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C33H46O5Si/c1-10-36-30(34)28(31(35)37-11-2)26-22-33(8,9)29(27(26)23(3)4)38-39(32(5,6)7,24-18-14-12-15-19-24)25-20-16-13-17-21-25/h12-21,26-29H,3,10-11,22H2,1-2,4-9H3/t26-,27+,29-/m1/s1 |
| InChIKey | BRRFFXWMCSUUBY-IUAQSZDVSA-N |
| XLogP | 5.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|