C22H42O4 — CID 10904739
(2S,4R,6R)-6-tert-butyl-2-[(2R,4S,6S)-6-tert-butyl-2,4-dimethyloxan-2-yl]peroxy-2,4-dimethyloxane (PubChem CID 10904739) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is (2S,4R,6R)-6-tert-butyl-2-[(2R,4S,6S)-6-tert-butyl-2,4-dimethyloxan-2-yl]peroxy-2,4-dimethyloxane.
| Compound Name | (2S,4R,6R)-6-tert-butyl-2-[(2R,4S,6S)-6-tert-butyl-2,4-dimethyloxan-2-yl]peroxy-2,4-dimethyloxane |
|---|---|
| PubChem CID | 10904739 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | (2S,4R,6R)-6-tert-butyl-2-[(2R,4S,6S)-6-tert-butyl-2,4-dimethyloxan-2-yl]peroxy-2,4-dimethyloxane |
| SMILES | C[C@@H]1C[C@H](C(C)(C)C)O[C@@](C)(OO[C@]2(C)C[C@@H](C)C[C@@H](C(C)(C)C)O2)C1 |
| InChI | InChI=1S/C22H42O4/c1-15-11-17(19(3,4)5)23-21(9,13-15)25-26-22(10)14-16(2)12-18(24-22)20(6,7)8/h15-18H,11-14H2,1-10H3/t15-,16+,17-,18+,21+,22- |
| InChIKey | BCACXUYDSXUDJI-YIVVYQTISA-N |
| XLogP | 6.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|