C22H14N4O2S — CID 10905396
9-methyl-4-phenylsulfanyl-3,5,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione (PubChem CID 10905396) has the molecular formula C22H14N4O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 9-methyl-4-phenylsulfanyl-3,5,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione.
| Compound Name | 9-methyl-4-phenylsulfanyl-3,5,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione |
|---|---|
| PubChem CID | 10905396 |
| Molecular Formula | C22H14N4O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 9-methyl-4-phenylsulfanyl-3,5,9,19-tetrazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,4,6,11,13,15,17-heptaene-8,10-dione |
| SMILES | CN1C(=O)c2c(c3c4ccccc4[nH]c3c3[nH]c(Sc4ccccc4)nc23)C1=O |
| InChI | InChI=1S/C22H14N4O2S/c1-26-20(27)15-14-12-9-5-6-10-13(12)23-17(14)19-18(16(15)21(26)28)24-22(25-19)29-11-7-3-2-4-8-11/h2-10,23H,1H3,(H,24,25) |
| InChIKey | XYUNJIAFHCROQE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|