C24H42O3Si — CID 10905601
(E,4R)-4-[(4S,5S,6R)-2,2-ditert-butyl-6-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-2-methylpent-2-enal (PubChem CID 10905601) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (E,4R)-4-[(4S,5S,6R)-2,2-ditert-butyl-6-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-2-methylpent-2-enal.
| Compound Name | (E,4R)-4-[(4S,5S,6R)-2,2-ditert-butyl-6-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-2-methylpent-2-enal |
|---|---|
| PubChem CID | 10905601 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (E,4R)-4-[(4S,5S,6R)-2,2-ditert-butyl-6-[(2R,3Z)-hexa-3,5-dien-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]-2-methylpent-2-enal |
| SMILES | C=C/C=C\[C@@H](C)[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]([C@H](C)/C=C(\C)C=O)[C@H]1C |
| InChI | InChI=1S/C24H42O3Si/c1-12-13-14-18(3)21-20(5)22(19(4)15-17(2)16-25)27-28(26-21,23(6,7)8)24(9,10)11/h12-16,18-22H,1H2,2-11H3/b14-13-,17-15+/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | ZTLLMSVCRNPMLK-QSPNSKEVSA-N |
| XLogP | 6.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|