C50H43N2O+ — CID 10908923
6-[2,6-bis(4-methylphenyl)-4-phenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] (PubChem CID 10908923) has the molecular formula C50H43N2O+ and a molecular weight of 687.91 g/mol. Its IUPAC name is 6-[2,6-bis(4-methylphenyl)-4-phenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole].
| Compound Name | 6-[2,6-bis(4-methylphenyl)-4-phenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 10908923 |
| Molecular Formula | C50H43N2O+ |
| Molecular Weight | 687.91 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | 6-[2,6-bis(4-methylphenyl)-4-phenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(C)cc3)[n+]2-c2cc3c(c(-c4ccccc4)c2)OC2(C=C3)N(C)c3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C50H43N2O/c1-34-20-24-38(25-21-34)46-31-41(36-14-8-6-9-15-36)32-47(39-26-22-35(2)23-27-39)52(46)42-30-40-28-29-50(49(3,4)44-18-12-13-19-45(44)51(50)5)53-48(40)43(33-42)37-16-10-7-11-17-37/h6-33H,1-5H3/q+1 |
| InChIKey | MDOBDGUBUQYRCQ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.91 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|