C48H38ClN2O+ — CID 11125649
6-[4-(4-chlorophenyl)-2,6-diphenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] (PubChem CID 11125649) has the molecular formula C48H38ClN2O+ and a molecular weight of 694.30 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)-2,6-diphenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole].
| Compound Name | 6-[4-(4-chlorophenyl)-2,6-diphenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 11125649 |
| Molecular Formula | C48H38ClN2O+ |
| Molecular Weight | 694.30 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | 6-[4-(4-chlorophenyl)-2,6-diphenylpyridin-1-ium-1-yl]-1',3',3'-trimethyl-8-phenylspiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(-[n+]3c(-c4ccccc4)cc(-c4ccc(Cl)cc4)cc3-c3ccccc3)cc(-c3ccccc3)c1O2 |
| InChI | InChI=1S/C48H38ClN2O/c1-47(2)42-21-13-14-22-43(42)50(3)48(47)28-27-37-29-40(32-41(46(37)52-48)34-15-7-4-8-16-34)51-44(35-17-9-5-10-18-35)30-38(33-23-25-39(49)26-24-33)31-45(51)36-19-11-6-12-20-36/h4-32H,1-3H3/q+1 |
| InChIKey | JWNDQZUNMYJWED-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.30 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|