C48H39ClN2O5 — CID 11828760
1',3',3'-trimethyl-8-phenyl-6-(2,4,6-triphenylpyridin-1-ium-1-yl)spiro[chromene-2,2'-indole] perchlorate (PubChem CID 11828760) has the molecular formula C48H39ClN2O5 and a molecular weight of 759.30 g/mol. Its IUPAC name is 1',3',3'-trimethyl-8-phenyl-6-(2,4,6-triphenylpyridin-1-ium-1-yl)spiro[chromene-2,2'-indole] perchlorate.
| Compound Name | 1',3',3'-trimethyl-8-phenyl-6-(2,4,6-triphenylpyridin-1-ium-1-yl)spiro[chromene-2,2'-indole] perchlorate |
|---|---|
| PubChem CID | 11828760 |
| Molecular Formula | C48H39ClN2O5 |
| Molecular Weight | 759.30 g/mol |
| Exact Mass | 758.25 |
| IUPAC Name | 1',3',3'-trimethyl-8-phenyl-6-(2,4,6-triphenylpyridin-1-ium-1-yl)spiro[chromene-2,2'-indole] perchlorate |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(-[n+]3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)cc(-c3ccccc3)c1O2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C48H39N2O.ClHO4/c1-47(2)42-26-16-17-27-43(42)49(3)48(47)29-28-38-30-40(33-41(46(38)51-48)35-20-10-5-11-21-35)50-44(36-22-12-6-13-23-36)31-39(34-18-8-4-9-19-34)32-45(50)37-24-14-7-15-25-37;2-1(3,4)5/h4-33H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ZFSGYSUXGCQYBH-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|