C22H36O4SSi — CID 10916881
[(2R)-3-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclopentyl]-2-phenylsulfanylpropyl] acetate (PubChem CID 10916881) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is [(2R)-3-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclopentyl]-2-phenylsulfanylpropyl] acetate.
| Compound Name | [(2R)-3-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclopentyl]-2-phenylsulfanylpropyl] acetate |
|---|---|
| PubChem CID | 10916881 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(2R)-3-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxycyclopentyl]-2-phenylsulfanylpropyl] acetate |
| SMILES | CC(=O)OC[C@@H](C[C@@]1(O)CCC[C@@H]1O[Si](C)(C)C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C22H36O4SSi/c1-17(23)25-16-19(27-18-11-8-7-9-12-18)15-22(24)14-10-13-20(22)26-28(5,6)21(2,3)4/h7-9,11-12,19-20,24H,10,13-16H2,1-6H3/t19-,20+,22+/m1/s1 |
| InChIKey | AWKDSCWIODUVPX-URVUXULASA-N |
| XLogP | 5.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|