C22H34O4SSi — CID 11133636
[(3R,5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-yl] acetate (PubChem CID 11133636) has the molecular formula C22H34O4SSi and a molecular weight of 422.66 g/mol. Its IUPAC name is [(3R,5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-yl] acetate.
| Compound Name | [(3R,5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-yl] acetate |
|---|---|
| PubChem CID | 11133636 |
| Molecular Formula | C22H34O4SSi |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(3R,5S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanyl-1-oxaspiro[4.4]nonan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@@]2(CCC[C@@H]2O[Si](C)(C)C(C)(C)C)C[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C22H34O4SSi/c1-16(23)24-20-18(27-17-11-8-7-9-12-17)15-22(25-20)14-10-13-19(22)26-28(5,6)21(2,3)4/h7-9,11-12,18-20H,10,13-15H2,1-6H3/t18-,19+,20?,22+/m1/s1 |
| InChIKey | RVKRTJKSVVFYRL-YLNUAKCDSA-N |
| XLogP | 5.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|