C34H58O4SSi — CID 14059927
tert-butyl-[(E,1S)-1-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-5-methyl-6-phenylsulfanylhex-4-enoxy]-dimethylsilane (PubChem CID 14059927) has the molecular formula C34H58O4SSi and a molecular weight of 590.99 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-1-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-5-methyl-6-phenylsulfanylhex-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-1-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-5-methyl-6-phenylsulfanylhex-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14059927 |
| Molecular Formula | C34H58O4SSi |
| Molecular Weight | 590.99 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | tert-butyl-[(E,1S)-1-[(2R,5R)-5-[(2S)-2-(methoxymethoxy)-6-methylhept-5-en-2-yl]-2-methyloxolan-2-yl]-5-methyl-6-phenylsulfanylhex-4-enoxy]-dimethylsilane |
| SMILES | COCO[C@@](C)(CCC=C(C)C)[C@H]1CC[C@](C)([C@H](CC/C=C(\C)CSc2ccccc2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C34H58O4SSi/c1-27(2)17-16-23-33(7,36-26-35-9)30-22-24-34(8,37-30)31(38-40(10,11)32(4,5)6)21-15-18-28(3)25-39-29-19-13-12-14-20-29/h12-14,17-20,30-31H,15-16,21-26H2,1-11H3/b28-18+/t30-,31+,33+,34-/m1/s1 |
| InChIKey | APFHKVPVHUYHKP-ZDCMBMLNSA-N |
| XLogP | 9.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.99 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|