C29H46O6SSi — CID 11124494
methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-5-enoate (PubChem CID 11124494) has the molecular formula C29H46O6SSi and a molecular weight of 550.83 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11124494 |
| Molecular Formula | C29H46O6SSi |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](C(OC)Sc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H46O6SSi/c1-21(30)34-24-20-25(35-37(7,8)29(2,3)4)27(28(33-6)36-22-16-12-11-13-17-22)23(24)18-14-9-10-15-19-26(31)32-5/h9,11-14,16-17,23-25,27-28H,10,15,18-20H2,1-8H3/b14-9-/t23-,24-,25+,27+,28?/m0/s1 |
| InChIKey | HBURBTOXJIMLSP-PYRFSSHZSA-N |
| XLogP | 7.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|