C30H48O6Si — CID 10918495
(1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-7-methylidene-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one (PubChem CID 10918495) has the molecular formula C30H48O6Si and a molecular weight of 532.79 g/mol. Its IUPAC name is (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-7-methylidene-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one.
| Compound Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-7-methylidene-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
|---|---|
| PubChem CID | 10918495 |
| Molecular Formula | C30H48O6Si |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-7-methylidene-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-en-3-one |
| SMILES | C=C1CCC[C@@]2(C)[C@H]3OC(C)(C)O[C@@H]3C3=C(C)[C@@H](O[Si](CC)(CC)CC)C[C@]4(OC(=O)O[C@H]4[C@H]12)C3(C)C |
| InChI | InChI=1S/C30H48O6Si/c1-11-37(12-2,13-3)36-20-17-30-24(32-26(31)35-30)21-18(4)15-14-16-29(21,10)25-23(33-28(8,9)34-25)22(19(20)5)27(30,6)7/h20-21,23-25H,4,11-17H2,1-3,5-10H3/t20-,21-,23+,24-,25-,29+,30+/m0/s1 |
| InChIKey | FNJIHMQXADTVIE-ZUTQBAPHSA-N |
| XLogP | 7.29 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|