C28H52O5Si2 — CID 10792190
(4S,4'aS,5'R,8'aS)-5'-[tert-butyl(dimethyl)silyl]oxy-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one (PubChem CID 10792190) has the molecular formula C28H52O5Si2 and a molecular weight of 524.89 g/mol. Its IUPAC name is (4S,4'aS,5'R,8'aS)-5'-[tert-butyl(dimethyl)silyl]oxy-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one.
| Compound Name | (4S,4'aS,5'R,8'aS)-5'-[tert-butyl(dimethyl)silyl]oxy-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
|---|---|
| PubChem CID | 10792190 |
| Molecular Formula | C28H52O5Si2 |
| Molecular Weight | 524.89 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | (4S,4'aS,5'R,8'aS)-5'-[tert-butyl(dimethyl)silyl]oxy-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)[C@]21COC(=O)O1 |
| InChI | InChI=1S/C28H52O5Si2/c1-24(2,3)34(10,11)31-18-20-17-21(33-35(12,13)25(4,5)6)22-26(7,8)15-14-16-27(22,9)28(20)19-30-23(29)32-28/h17,21-22H,14-16,18-19H2,1-13H3/t21-,22+,27+,28-/m1/s1 |
| InChIKey | OHIGYBVFNDKLHS-BYXJMBFLSA-N |
| XLogP | 8.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.89 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|