C32H54O7Si2 — CID 11135809
(1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-7-trimethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-7,17-dien-3-one (PubChem CID 11135809) has the molecular formula C32H54O7Si2 and a molecular weight of 606.95 g/mol. Its IUPAC name is (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-7-trimethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-7,17-dien-3-one.
| Compound Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-7-trimethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-7,17-dien-3-one |
|---|---|
| PubChem CID | 11135809 |
| Molecular Formula | C32H54O7Si2 |
| Molecular Weight | 606.95 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-7-trimethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicosa-7,17-dien-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2[C@@H]2C(O[Si](C)(C)C)=CCC[C@@]2(C)[C@H]2OC(C)(C)O[C@@H]2C(=C1C)C3(C)C |
| InChI | InChI=1S/C32H54O7Si2/c1-13-41(14-2,15-3)39-22-19-32-26(34-28(33)37-32)24-21(38-40(10,11)12)17-16-18-31(24,9)27-25(35-30(7,8)36-27)23(20(22)4)29(32,5)6/h17,22,24-27H,13-16,18-19H2,1-12H3/t22-,24-,25+,26-,27-,31+,32+/m0/s1 |
| InChIKey | AHLXZEVTMRAROW-JEEDQLLKSA-N |
| XLogP | 8.08 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.95 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|