C18H34O2Si2 — CID 10925810
(1S)-1-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclopentyl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 10925810) has the molecular formula C18H34O2Si2 and a molecular weight of 338.64 g/mol. Its IUPAC name is (1S)-1-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclopentyl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1S)-1-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclopentyl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 10925810 |
| Molecular Formula | C18H34O2Si2 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1S)-1-[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclopentyl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | C=C1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H34O2Si2/c1-14-12-15(20-22(8,9)18(2,3)4)13-16(14)17(19)10-11-21(5,6)7/h15-17,19H,1,12-13H2,2-9H3/t15-,16+,17+/m0/s1 |
| InChIKey | WCNMXVAEKLXRHW-GVDBMIGSSA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|