About butanamide
butanamide (PubChem CID 10927) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is butanamide.
Molecular Properties
| Compound Name | butanamide |
| PubChem CID | 10927 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | butanamide |
| SMILES | CCCC(N)=O |
| InChI | InChI=1S/C4H9NO/c1-2-3-4(5)6/h2-3H2,1H3,(H2,5,6) |
| InChIKey | DNSISZSEWVHGLH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide?
The IUPAC name of butanamide (CID 10927) is butanamide.
What is the SMILES notation for butanamide?
The canonical SMILES for butanamide is CCCC(N)=O.
What is the InChIKey of butanamide?
The InChIKey is DNSISZSEWVHGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO/c1-2-3-4(5)6/h2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide?
butanamide has a molecular weight of 87.12 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide is sourced from PubChem (CID 10927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).