C37H33FeNO6+2 — CID 10930278
CID 10930278 (PubChem CID 10930278) has the molecular formula C37H33FeNO6+2 and a molecular weight of 643.52 g/mol.
| Compound Name | CID 10930278 |
|---|---|
| PubChem CID | 10930278 |
| Molecular Formula | C37H33FeNO6+2 |
| Molecular Weight | 643.52 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | — |
| SMILES | COC(=O)/C(=C/[C]1[CH][CH][CH][CH]1)NC(=O)OCc1ccccc1.[CH]1[CH][CH][C](C2OC(c3ccccc3)C(c3ccccc3)O2)[CH]1.[Fe+2] |
| InChI | InChI=1S/C20H17O2.C17H16NO4.Fe/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)22-20(21-18)17-13-7-8-14-17;1-21-16(19)15(11-13-7-5-6-8-13)18-17(20)22-12-14-9-3-2-4-10-14;/h1-14,18-20H;2-11H,12H2,1H3,(H,18,20);/q;;+2/b;15-11-; |
| InChIKey | PECNLCLUZLDDGQ-UUDWHHQQSA-N |
| XLogP | 6.62 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.52 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|