C16H19N3O4 — CID 10936023
N-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,4-dinitroaniline (PubChem CID 10936023) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,4-dinitroaniline.
| Compound Name | N-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 10936023 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,4-dinitroaniline |
| SMILES | CC1(C)[C@@H]2CC=C(CNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@H]1C2 |
| InChI | InChI=1S/C16H19N3O4/c1-16(2)11-4-3-10(13(16)7-11)9-17-14-6-5-12(18(20)21)8-15(14)19(22)23/h3,5-6,8,11,13,17H,4,7,9H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | DCNUCWLMUCASKL-DGCLKSJQSA-N |
| XLogP | 3.91 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|