C18H18F3NO4S — CID 10938247
(1-benzyl-5-methyl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl) trifluoromethanesulfonate (PubChem CID 10938247) has the molecular formula C18H18F3NO4S and a molecular weight of 401.41 g/mol. Its IUPAC name is (1-benzyl-5-methyl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl) trifluoromethanesulfonate.
| Compound Name | (1-benzyl-5-methyl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10938247 |
| Molecular Formula | C18H18F3NO4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (1-benzyl-5-methyl-2-oxo-5,6,7,8-tetrahydroquinolin-3-yl) trifluoromethanesulfonate |
| SMILES | CC1CCCc2c1cc(OS(=O)(=O)C(F)(F)F)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C18H18F3NO4S/c1-12-6-5-9-15-14(12)10-16(26-27(24,25)18(19,20)21)17(23)22(15)11-13-7-3-2-4-8-13/h2-4,7-8,10,12H,5-6,9,11H2,1H3 |
| InChIKey | XVDUWQHZCNMIIM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|