About (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate
(2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate (PubChem CID 139389874) has the molecular formula C11H10F3NO5S2
and a molecular weight of 357.33 g/mol. Its IUPAC name is (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate |
| PubChem CID | 139389874 |
| Molecular Formula | C11H10F3NO5S2 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate |
| SMILES | O=S1(=O)C=C(OS(=O)(=O)C(F)(F)F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C11H10F3NO5S2/c12-11(13,14)22(18,19)20-10-7-15(21(16,17)8-10)6-9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | DBMQWYQHGPSHPS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate?
The IUPAC name of (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate (CID 139389874) is (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate is O=S1(=O)C=C(OS(=O)(=O)C(F)(F)F)CN1Cc1ccccc1.
What is the InChIKey of (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate?
The InChIKey is DBMQWYQHGPSHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO5S2/c12-11(13,14)22(18,19)20-10-7-15(21(16,17)8-10)6-9-4-2-1-3-5-9/h1-5,8H,6-7H2.
What are the key properties of (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate?
(2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate has a molecular weight of 357.33 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-1,1-dioxo-3H-1,2-thiazol-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 139389874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).