C16H16F3NO5S — CID 134261897
(E)-3-[1-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoic acid (PubChem CID 134261897) has the molecular formula C16H16F3NO5S and a molecular weight of 391.37 g/mol. Its IUPAC name is (E)-3-[1-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134261897 |
| Molecular Formula | C16H16F3NO5S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (E)-3-[1-benzyl-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/C1=C(OS(=O)(=O)C(F)(F)F)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H16F3NO5S/c17-16(18,19)26(23,24)25-14-8-9-20(10-12-4-2-1-3-5-12)11-13(14)6-7-15(21)22/h1-7H,8-11H2,(H,21,22)/b7-6+ |
| InChIKey | GUNSLROBEGEHKY-VOTSOKGWSA-N |
| XLogP | 2.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|