C25H44O2Si — CID 10938341
[(2R)-2-[(1R,3R,3aR,7R,7aR)-4-methyl-3-(2-methylprop-2-enyl)-7-propan-2-yl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]hex-5-en-2-yl]oxy-trimethylsilane (PubChem CID 10938341) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is [(2R)-2-[(1R,3R,3aR,7R,7aR)-4-methyl-3-(2-methylprop-2-enyl)-7-propan-2-yl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]hex-5-en-2-yl]oxy-trimethylsilane.
| Compound Name | [(2R)-2-[(1R,3R,3aR,7R,7aR)-4-methyl-3-(2-methylprop-2-enyl)-7-propan-2-yl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]hex-5-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10938341 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | [(2R)-2-[(1R,3R,3aR,7R,7aR)-4-methyl-3-(2-methylprop-2-enyl)-7-propan-2-yl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]hex-5-en-2-yl]oxy-trimethylsilane |
| SMILES | C=CCC[C@@](C)(O[Si](C)(C)C)[C@@H]1O[C@H](CC(=C)C)[C@H]2C(C)=CC[C@H](C(C)C)[C@H]21 |
| InChI | InChI=1S/C25H44O2Si/c1-11-12-15-25(7,27-28(8,9)10)24-23-20(18(4)5)14-13-19(6)22(23)21(26-24)16-17(2)3/h11,13,18,20-24H,1-2,12,14-16H2,3-10H3/t20-,21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | HYFWDGUMQXHFFN-VRVGQERDSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|