C35H72O3Si2 — CID 11707014
triethyl-[(E,1R,2R)-4-ethyl-1-[(2S,4S,5S)-5-[(1R,2R)-1-ethyl-2-triethylsilyloxybutyl]-2,4-dimethyloxolan-2-yl]-2-methyloct-4-enoxy]silane (PubChem CID 11707014) has the molecular formula C35H72O3Si2 and a molecular weight of 597.13 g/mol. Its IUPAC name is triethyl-[(E,1R,2R)-4-ethyl-1-[(2S,4S,5S)-5-[(1R,2R)-1-ethyl-2-triethylsilyloxybutyl]-2,4-dimethyloxolan-2-yl]-2-methyloct-4-enoxy]silane.
| Compound Name | triethyl-[(E,1R,2R)-4-ethyl-1-[(2S,4S,5S)-5-[(1R,2R)-1-ethyl-2-triethylsilyloxybutyl]-2,4-dimethyloxolan-2-yl]-2-methyloct-4-enoxy]silane |
|---|---|
| PubChem CID | 11707014 |
| Molecular Formula | C35H72O3Si2 |
| Molecular Weight | 597.13 g/mol |
| Exact Mass | 596.50 |
| IUPAC Name | triethyl-[(E,1R,2R)-4-ethyl-1-[(2S,4S,5S)-5-[(1R,2R)-1-ethyl-2-triethylsilyloxybutyl]-2,4-dimethyloxolan-2-yl]-2-methyloct-4-enoxy]silane |
| SMILES | CCC/C=C(\CC)C[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@]1(C)C[C@H](C)[C@@H]([C@@H](CC)[C@@H](CC)O[Si](CC)(CC)CC)O1 |
| InChI | InChI=1S/C35H72O3Si2/c1-14-24-25-30(15-2)26-28(11)34(38-40(21-8,22-9)23-10)35(13)27-29(12)33(36-35)31(16-3)32(17-4)37-39(18-5,19-6)20-7/h25,28-29,31-34H,14-24,26-27H2,1-13H3/b30-25+/t28-,29+,31+,32-,33+,34-,35+/m1/s1 |
| InChIKey | LVKBYJFMCDMNBU-LSZJKXFJSA-N |
| XLogP | 11.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.13 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|