C16H32O2Si — CID 11087337
[(E,1R)-4-ethyl-1-[(2S)-2-methyloxolan-2-yl]hex-4-enoxy]-trimethylsilane (PubChem CID 11087337) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is [(E,1R)-4-ethyl-1-[(2S)-2-methyloxolan-2-yl]hex-4-enoxy]-trimethylsilane.
| Compound Name | [(E,1R)-4-ethyl-1-[(2S)-2-methyloxolan-2-yl]hex-4-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11087337 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | [(E,1R)-4-ethyl-1-[(2S)-2-methyloxolan-2-yl]hex-4-enoxy]-trimethylsilane |
| SMILES | C/C=C(\CC)CC[C@@H](O[Si](C)(C)C)[C@]1(C)CCCO1 |
| InChI | InChI=1S/C16H32O2Si/c1-7-14(8-2)10-11-15(18-19(4,5)6)16(3)12-9-13-17-16/h7,15H,8-13H2,1-6H3/b14-7+/t15-,16+/m1/s1 |
| InChIKey | QMFJBMRQGKKDIV-RBBJEVKSSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|