C22H38O2Si — CID 11728178
trimethyl-[[(1R,2R,6R,7R,8R,9R,11Z)-3,9,12-trimethyl-6-propan-2-yl-14-oxatricyclo[6.5.1.02,7]tetradeca-3,11-dien-9-yl]oxy]silane (PubChem CID 11728178) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is trimethyl-[[(1R,2R,6R,7R,8R,9R,11Z)-3,9,12-trimethyl-6-propan-2-yl-14-oxatricyclo[6.5.1.02,7]tetradeca-3,11-dien-9-yl]oxy]silane.
| Compound Name | trimethyl-[[(1R,2R,6R,7R,8R,9R,11Z)-3,9,12-trimethyl-6-propan-2-yl-14-oxatricyclo[6.5.1.02,7]tetradeca-3,11-dien-9-yl]oxy]silane |
|---|---|
| PubChem CID | 11728178 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | trimethyl-[[(1R,2R,6R,7R,8R,9R,11Z)-3,9,12-trimethyl-6-propan-2-yl-14-oxatricyclo[6.5.1.02,7]tetradeca-3,11-dien-9-yl]oxy]silane |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C/C(C)=C\C[C@@](C)(O[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C22H38O2Si/c1-14(2)17-10-9-16(4)19-18-13-15(3)11-12-22(5,24-25(6,7)8)21(23-18)20(17)19/h9,11,14,17-21H,10,12-13H2,1-8H3/b15-11-/t17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | BHRVJOMPZAHLEZ-BQBFPXCHSA-N |
| XLogP | 5.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|