C31H42O4Si — CID 10940128
5-[tert-butyl(diphenyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one (PubChem CID 10940128) has the molecular formula C31H42O4Si and a molecular weight of 506.76 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 10940128 |
| Molecular Formula | C31H42O4Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one |
| SMILES | CC1=C(C2OCC(C)(C)CO2)C(C)(C)C(=O)CC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H42O4Si/c1-22-25(19-26(32)31(7,8)27(22)28-33-20-30(5,6)21-34-28)35-36(29(2,3)4,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,25,28H,19-21H2,1-8H3 |
| InChIKey | JHIIFBBKAKARJU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|