C22H28N8S — CID 109423334
3-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109423334) has the molecular formula C22H28N8S and a molecular weight of 436.59 g/mol. Its IUPAC name is 3-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109423334 |
| Molecular Formula | C22H28N8S |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[3-[5-amino-4-cyano-1-(4-methylphenyl)pyrazol-3-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCc1nn(-c2ccc(C)cc2)c(N)c1C#N)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C22H28N8S/c1-15-7-9-18(10-8-15)30-21(24)19(12-23)20(28-30)6-5-11-26-22(25-3)29(4)13-17-14-31-16(2)27-17/h7-10,14H,5-6,11,13,24H2,1-4H3,(H,25,26) |
| InChIKey | BUBVPJSMHPYZKK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|