C21H29N7O — CID 109436451
N'-methyl-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436451) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is N'-methyl-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436451 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N'-methyl-N-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCN1c2ccccc2CC1C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C21H29N7O/c1-16-12-17-6-4-5-7-19(17)27(16)9-8-23-21(22-2)26-10-11-28(20(29)15-26)18-13-24-25(3)14-18/h4-7,13-14,16H,8-12,15H2,1-3H3,(H,22,23) |
| InChIKey | LSPVEMFPFMVNCM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|