C20H31FN4O2S — CID 109444489
1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 109444489) has the molecular formula C20H31FN4O2S and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109444489 |
| Molecular Formula | C20H31FN4O2S |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(CC1CC1)C1CC1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C20H31FN4O2S/c1-22-20(23-9-10-25(19-7-8-19)13-15-3-4-15)24-12-17-11-18(21)6-5-16(17)14-28(2,26)27/h5-6,11,15,19H,3-4,7-10,12-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | JRAXKYKXNOUJRR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|