C18H33F3IN3O2 — CID 109449152
N'-methyl-4-(oxan-2-ylmethoxy)-N-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449152) has the molecular formula C18H33F3IN3O2 and a molecular weight of 507.38 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449152 |
| Molecular Formula | C18H33F3IN3O2 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(5,5,5-trifluoropentyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCC(F)(F)F)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C18H32F3N3O2.HI/c1-22-17(23-10-4-3-9-18(19,20)21)24-11-7-15(8-12-24)26-14-16-6-2-5-13-25-16;/h15-16H,2-14H2,1H3,(H,22,23);1H |
| InChIKey | QEDLOOOXBXCMHW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|