C21H29F2IN6 — CID 109451406
N-[(1-cyclopentylpyrazol-3-yl)methyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109451406) has the molecular formula C21H29F2IN6 and a molecular weight of 530.41 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109451406 |
| Molecular Formula | C21H29F2IN6 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccn(C2CCCC2)n1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C21H28F2N6.HI/c1-24-21(25-15-17-8-9-29(26-17)18-4-2-3-5-18)28-12-10-27(11-13-28)20-14-16(22)6-7-19(20)23;/h6-9,14,18H,2-5,10-13,15H2,1H3,(H,24,25);1H |
| InChIKey | OQCWLHAHIJRBTR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|