C15H31N3 — CID 109452839
N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylbutyl)azetidine-1-carboximidamide (PubChem CID 109452839) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylbutyl)azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylbutyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452839 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-(3-methylbutyl)azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(C)C)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C15H31N3/c1-8-16-13(17-10-9-12(2)3)18-11-14(4,5)15(18,6)7/h12H,8-11H2,1-7H3,(H,16,17) |
| InChIKey | CVDOPUFKMJMEPH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|