C20H27FIN5OS — CID 109454513
3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 109454513) has the molecular formula C20H27FIN5OS and a molecular weight of 531.44 g/mol. Its IUPAC name is 3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109454513 |
| Molecular Formula | C20H27FIN5OS |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-1-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)N(C)Cc1csc(C(C)OC)n1.I |
| InChI | InChI=1S/C20H26FN5OS.HI/c1-13(27-4)19-25-16(12-28-19)11-26(3)20(22-2)23-8-7-14-10-24-18-6-5-15(21)9-17(14)18;/h5-6,9-10,12-13,24H,7-8,11H2,1-4H3,(H,22,23);1H |
| InChIKey | JVIDCJVMQARCQK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|