C13H25N3 — CID 109482953
3-cyclopropyl-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109482953) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-hept-6-enyl-1,2-dimethylguanidine.
| Compound Name | 3-cyclopropyl-1-hept-6-enyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109482953 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 3-cyclopropyl-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NC1CC1 |
| InChI | InChI=1S/C13H25N3/c1-4-5-6-7-8-11-16(3)13(14-2)15-12-9-10-12/h4,12H,1,5-11H2,2-3H3,(H,14,15) |
| InChIKey | LHAJGSMSUUUHJD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|