C15H27IN4O2S — CID 109488402
N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488402) has the molecular formula C15H27IN4O2S and a molecular weight of 454.38 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488402 |
| Molecular Formula | C15H27IN4O2S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-1-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN1C(=O)CCCC1=O)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C15H26N4O2S.HI/c1-15(2)11-18(9-10-22-15)14(16-3)17-7-8-19-12(20)5-4-6-13(19)21;/h4-11H2,1-3H3,(H,16,17);1H |
| InChIKey | PQLFDZHNEFOKKN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|