C15H29N3 — CID 109490264
N-ethyl-3-methyl-N'-prop-2-enyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490264) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-prop-2-enyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-3-methyl-N'-prop-2-enyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490264 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | N-ethyl-3-methyl-N'-prop-2-enyl-3-propylpiperidine-1-carboximidamide |
| SMILES | C=CC/N=C(\NCC)N1CCCC(C)(CCC)C1 |
| InChI | InChI=1S/C15H29N3/c1-5-9-15(4)10-8-12-18(13-15)14(16-7-3)17-11-6-2/h6H,2,5,7-13H2,1,3-4H3,(H,16,17) |
| InChIKey | PTMKQQOBSTXPBJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|