C11H16OSi — CID 10954404
3-bicyclo[4.2.0]octa-1(6),2,4-trienyloxy(trimethyl)silane (PubChem CID 10954404) has the molecular formula C11H16OSi and a molecular weight of 192.33 g/mol. Its IUPAC name is 3-bicyclo[4.2.0]octa-1(6),2,4-trienyloxy(trimethyl)silane.
| Compound Name | 3-bicyclo[4.2.0]octa-1(6),2,4-trienyloxy(trimethyl)silane |
|---|---|
| PubChem CID | 10954404 |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-bicyclo[4.2.0]octa-1(6),2,4-trienyloxy(trimethyl)silane |
| SMILES | C[Si](C)(C)Oc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C11H16OSi/c1-13(2,3)12-11-7-6-9-4-5-10(9)8-11/h6-8H,4-5H2,1-3H3 |
| InChIKey | BUQTWFPTUMFYAB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|