C16H22O2 — CID 10955853
(1S,6S,8S,9R,10S,14R)-8-methoxytetracyclo[7.6.0.01,6.010,14]pentadec-12-en-2-one (PubChem CID 10955853) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (1S,6S,8S,9R,10S,14R)-8-methoxytetracyclo[7.6.0.01,6.010,14]pentadec-12-en-2-one.
| Compound Name | (1S,6S,8S,9R,10S,14R)-8-methoxytetracyclo[7.6.0.01,6.010,14]pentadec-12-en-2-one |
|---|---|
| PubChem CID | 10955853 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (1S,6S,8S,9R,10S,14R)-8-methoxytetracyclo[7.6.0.01,6.010,14]pentadec-12-en-2-one |
| SMILES | CO[C@H]1C[C@@H]2CCCC(=O)[C@@]23C[C@@H]2C=CC[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C16H22O2/c1-18-13-8-11-5-3-7-14(17)16(11)9-10-4-2-6-12(10)15(13)16/h2,4,10-13,15H,3,5-9H2,1H3/t10-,11-,12-,13-,15-,16+/m0/s1 |
| InChIKey | GTODHBXRROWPEC-JKPJVAMOSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|