C15H24O3 — CID 10956046
(1S,2R,6R,7R,8R,9R,11S)-6,9-dihydroxy-3,3,7,11-tetramethyltricyclo[5.4.0.02,8]undecan-4-one (PubChem CID 10956046) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2R,6R,7R,8R,9R,11S)-6,9-dihydroxy-3,3,7,11-tetramethyltricyclo[5.4.0.02,8]undecan-4-one.
| Compound Name | (1S,2R,6R,7R,8R,9R,11S)-6,9-dihydroxy-3,3,7,11-tetramethyltricyclo[5.4.0.02,8]undecan-4-one |
|---|---|
| PubChem CID | 10956046 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2R,6R,7R,8R,9R,11S)-6,9-dihydroxy-3,3,7,11-tetramethyltricyclo[5.4.0.02,8]undecan-4-one |
| SMILES | C[C@H]1C[C@@H](O)[C@@H]2[C@H]3[C@H]1[C@@]2(C)[C@H](O)CC(=O)C3(C)C |
| InChI | InChI=1S/C15H24O3/c1-7-5-8(16)12-13-11(7)15(12,4)10(18)6-9(17)14(13,2)3/h7-8,10-13,16,18H,5-6H2,1-4H3/t7-,8+,10+,11-,12+,13+,15+/m0/s1 |
| InChIKey | ZIUJEWOVEXZJLQ-HHAJWIGKSA-N |
| XLogP | 1.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |