C21H44O4Si2 — CID 10960712
(2S,3S,3aS,4R,5S,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-8-trimethylsilyloxy-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-4,5-diol (PubChem CID 10960712) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is (2S,3S,3aS,4R,5S,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-8-trimethylsilyloxy-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-4,5-diol.
| Compound Name | (2S,3S,3aS,4R,5S,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-8-trimethylsilyloxy-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-4,5-diol |
|---|---|
| PubChem CID | 10960712 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (2S,3S,3aS,4R,5S,8R,8aR)-2-[tert-butyl(dimethyl)silyl]oxy-3,8-dimethyl-8-trimethylsilyloxy-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene-4,5-diol |
| SMILES | C[C@H]1[C@@H]2[C@@H](O)[C@@H](O)CC[C@@](C)(O[Si](C)(C)C)[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O4Si2/c1-14-17(24-27(9,10)20(2,3)4)13-15-18(14)19(23)16(22)11-12-21(15,5)25-26(6,7)8/h14-19,22-23H,11-13H2,1-10H3/t14-,15-,16+,17+,18+,19+,21-/m1/s1 |
| InChIKey | MCBPYEQVRPSSLJ-CLVAROQRSA-N |
| XLogP | 4.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|