C21H30O7S — CID 10960895
[(1S,3S,3'S,4S)-1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10960895) has the molecular formula C21H30O7S and a molecular weight of 426.53 g/mol. Its IUPAC name is [(1S,3S,3'S,4S)-1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,3S,3'S,4S)-1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10960895 |
| Molecular Formula | C21H30O7S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(1S,3S,3'S,4S)-1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2CC[C@]3(OC2)O[C@@]2(O)CC[C@]3(C)OC2(C)C)cc1 |
| InChI | InChI=1S/C21H30O7S/c1-15-5-7-17(8-6-15)29(23,24)26-14-16-9-10-21(25-13-16)19(4)11-12-20(22,28-21)18(2,3)27-19/h5-8,16,22H,9-14H2,1-4H3/t16-,19-,20-,21-/m0/s1 |
| InChIKey | UEPAEAOUWYJYQU-FIRPJDEBSA-N |
| XLogP | 2.89 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|