C22H29NO8 — CID 10961069
(1'S,2'R,4R,6'R,9'R)-4',4',11',11'-tetramethyl-3-[(1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]spiro[1,3-oxazolidine-4,8'-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane]-2-one (PubChem CID 10961069) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is (1'S,2'R,4R,6'R,9'R)-4',4',11',11'-tetramethyl-3-[(1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]spiro[1,3-oxazolidine-4,8'-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane]-2-one.
| Compound Name | (1'S,2'R,4R,6'R,9'R)-4',4',11',11'-tetramethyl-3-[(1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]spiro[1,3-oxazolidine-4,8'-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane]-2-one |
|---|---|
| PubChem CID | 10961069 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (1'S,2'R,4R,6'R,9'R)-4',4',11',11'-tetramethyl-3-[(1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carbonyl]spiro[1,3-oxazolidine-4,8'-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane]-2-one |
| SMILES | C[C@H]1[C@H](C(=O)N2C(=O)OC[C@]23O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]23)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C22H29NO8/c1-10-11-6-7-12(8-11)13(10)17(24)23-19(25)26-9-22(23)16-14(27-20(2,3)29-16)15-18(31-22)30-21(4,5)28-15/h6-7,10-16,18H,8-9H2,1-5H3/t10-,11+,12-,13+,14-,15-,16-,18+,22-/m1/s1 |
| InChIKey | CSOZKDWWGRKKDK-HLLWNSNMSA-N |
| XLogP | 2.15 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|