C15H16OSe — CID 15424473
Se-phenyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboselenoate (PubChem CID 15424473) has the molecular formula C15H16OSe and a molecular weight of 291.25 g/mol. Its IUPAC name is Se-phenyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboselenoate.
| Compound Name | Se-phenyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboselenoate |
|---|---|
| PubChem CID | 15424473 |
| Molecular Formula | C15H16OSe |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | Se-phenyl (1S,2S,3R,4R)-3-methylbicyclo[2.2.1]hept-5-ene-2-carboselenoate |
| SMILES | C[C@H]1[C@H](C(=O)[Se]c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H16OSe/c1-10-11-7-8-12(9-11)14(10)15(16)17-13-5-3-2-4-6-13/h2-8,10-12,14H,9H2,1H3/t10-,11+,12-,14+/m1/s1 |
| InChIKey | CBOLZDYWKURSKW-CZXHOFHRSA-N |
| XLogP | 2.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|