C26H54O4Si3 — CID 10962328
tert-butyl-[[(1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-en-2-yl]methoxy]-dimethylsilane (PubChem CID 10962328) has the molecular formula C26H54O4Si3 and a molecular weight of 514.97 g/mol. Its IUPAC name is tert-butyl-[[(1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-en-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-en-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10962328 |
| Molecular Formula | C26H54O4Si3 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | tert-butyl-[[(1R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-6-oxabicyclo[3.1.0]hex-2-en-2-yl]methoxy]-dimethylsilane |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(O[Si](C)(C)C(C)(C)C)C=C(CO[Si](C)(C)C(C)(C)C)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C26H54O4Si3/c1-19(29-32(13,14)24(5,6)7)26(30-33(15,16)25(8,9)10)17-20(21-22(26)28-21)18-27-31(11,12)23(2,3)4/h17,19,21-22H,18H2,1-16H3/t19-,21+,22+,26+/m0/s1 |
| InChIKey | NHAIXBSRTVCPOE-BLJFENDVSA-N |
| XLogP | 7.89 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|