C32H68O4Si3 — CID 11180956
[(E)-1-[(2R,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-enoxy]-trimethylsilane (PubChem CID 11180956) has the molecular formula C32H68O4Si3 and a molecular weight of 601.15 g/mol. Its IUPAC name is [(E)-1-[(2R,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-enoxy]-trimethylsilane.
| Compound Name | [(E)-1-[(2R,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11180956 |
| Molecular Formula | C32H68O4Si3 |
| Molecular Weight | 601.15 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | [(E)-1-[(2R,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-enoxy]-trimethylsilane |
| SMILES | CC/C=C(\C)C(O[Si](C)(C)C)[C@]1(C)O[C@H]1[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H68O4Si3/c1-19-20-28(14)30(36-37(16,17)18)32(15)31(34-32)29(35-39(25(8)9,26(10)11)27(12)13)21-33-38(22(2)3,23(4)5)24(6)7/h20,22-27,29-31H,19,21H2,1-18H3/b28-20+/t29-,30?,31+,32+/m1/s1 |
| InChIKey | AYFLWBJKIFBQQB-LWSHAMMPSA-N |
| XLogP | 10.47 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.15 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|