C12H23BrO2 — CID 10967877
(Z)-6-bromo-1,1-di(propan-2-yloxy)hex-3-ene (PubChem CID 10967877) has the molecular formula C12H23BrO2 and a molecular weight of 279.22 g/mol. Its IUPAC name is (Z)-6-bromo-1,1-di(propan-2-yloxy)hex-3-ene.
| Compound Name | (Z)-6-bromo-1,1-di(propan-2-yloxy)hex-3-ene |
|---|---|
| PubChem CID | 10967877 |
| Molecular Formula | C12H23BrO2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (Z)-6-bromo-1,1-di(propan-2-yloxy)hex-3-ene |
| SMILES | CC(C)OC(C/C=C\CCBr)OC(C)C |
| InChI | InChI=1S/C12H23BrO2/c1-10(2)14-12(15-11(3)4)8-6-5-7-9-13/h5-6,10-12H,7-9H2,1-4H3/b6-5- |
| InChIKey | HOUFPTLPPJIRNI-WAYWQWQTSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|