C13H25BrO3 — CID 89266927
5-Bromo-5-(3,3-diethoxypropoxy)-2-methylpent-2-ene (PubChem CID 89266927) has the molecular formula C13H25BrO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is 5-bromo-5-(3,3-diethoxypropoxy)-2-methylpent-2-ene.
| Compound Name | 5-Bromo-5-(3,3-diethoxypropoxy)-2-methylpent-2-ene |
|---|---|
| PubChem CID | 89266927 |
| Molecular Formula | C13H25BrO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 5-bromo-5-(3,3-diethoxypropoxy)-2-methylpent-2-ene |
| SMILES | CCOC(CCOC(CC=C(C)C)Br)OCC |
| InChI | InChI=1S/C13H25BrO3/c1-5-15-13(16-6-2)9-10-17-12(14)8-7-11(3)4/h7,12-13H,5-6,8-10H2,1-4H3 |
| InChIKey | DQSGZWCUFJGSIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | 197 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|