C20H17Cl2CoN3 — CID 10972017
dichlorocobalt;N,N'-diphenyl-N-(phenyliminomethyl)methanimidamide (PubChem CID 10972017) has the molecular formula C20H17Cl2CoN3 and a molecular weight of 429.22 g/mol. Its IUPAC name is dichlorocobalt;N,N'-diphenyl-N-(phenyliminomethyl)methanimidamide.
| Compound Name | dichlorocobalt;N,N'-diphenyl-N-(phenyliminomethyl)methanimidamide |
|---|---|
| PubChem CID | 10972017 |
| Molecular Formula | C20H17Cl2CoN3 |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | dichlorocobalt;N,N'-diphenyl-N-(phenyliminomethyl)methanimidamide |
| SMILES | C(=N/c1ccccc1)\N(/C=N/c1ccccc1)c1ccccc1.Cl[Co]Cl |
| InChI | InChI=1S/C20H17N3.2ClH.Co/c1-4-10-18(11-5-1)21-16-23(20-14-8-3-9-15-20)17-22-19-12-6-2-7-13-19;;;/h1-17H;2*1H;/q;;;+2/p-2/b21-16+,22-17+;;; |
| InChIKey | ICCDNLBAXHTMMF-BXDQHYGTSA-L |
| XLogP | 6.59 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|